Products 938458-70-9
CAS 938458-70-9 is the registry number for (4-Chlorophenyl)[3-(methoxymethoxy)phenyl]methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
(4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone (CAS 938458-70-9) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: (4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone. InChIKey: TUOYUPPWCASZBI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | (4-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone |
| InChIKey | TUOYUPPWCASZBI-UHFFFAOYSA-N |
| SMILES | COCOC1=CC=CC(=C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)