Methyl 4-(difluoromethoxy)-3-nitrobenzoate, 95+%
cas: 1154278-25-7 — see every product listed under this CAS number, including other names
Methyl 4-(difluoromethoxy)-3-nitrobenzoate, 95+% (CAS 1154278-25-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A641518-250mg |
| cas | 1154278-25-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1193.62 Pln | |
| Ambeed | 5g | 4558.94 Pln | |
| BLDpharm | 100mg | 486.52 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1280.68 Pln | |
| BLDpharm | 5g | 4907.19 Pln | |
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1048.40 Pln | |
| Chemat | 1g | 2718.80 Pln | |
| Fluorochem | 100mg | 1174.60 Pln | |
| Fluorochem | 250mg | 1934.75 Pln | |
| Fluorochem | 1g | 5037.83 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-(difluoromethoxy)-3-nitrobenzoate (CAS 1154278-25-7) is a chemical compound with the molecular formula C9H7F2NO5 and a molecular weight of 247.15 g/mol. IUPAC name: methyl 4-(difluoromethoxy)-3-nitrobenzoate. InChIKey: AHAKPCUKFZCCBV-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO5 |
|---|---|
| Molecular weight | 247.15 g/mol |
| IUPAC name | methyl 4-(difluoromethoxy)-3-nitrobenzoate |
| InChIKey | AHAKPCUKFZCCBV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)OC(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)