Products 1178286-57-1
CAS 1178286-57-1 is the registry number for 4-(2,2-Difluoroethoxy)-3-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(2,2-difluoroethoxy)-3-nitrobenzoic acid (CAS 1178286-57-1) is a chemical compound with the molecular formula C9H7F2NO5 and a molecular weight of 247.15 g/mol. IUPAC name: 4-(2,2-difluoroethoxy)-3-nitrobenzoic acid. InChIKey: FCGJOVZTWKATIG-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO5 |
|---|---|
| Molecular weight | 247.15 g/mol |
| IUPAC name | 4-(2,2-difluoroethoxy)-3-nitrobenzoic acid |
| InChIKey | FCGJOVZTWKATIG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)[N+](=O)[O-])OCC(F)F |
Computed by PubChem (NCBI)