CAS 2181-98-8 appears in our catalog under these names: (4-Methoxy-4-oxobut-2-en-1-yl)triphenylphosphonium bromide, 98%, 98%, Methyl 4-(triphenylphosphonio)crotonate bromide/ 98%, Methyl 4-(triphenylphosphonio)crotonate bromide, 96%. Offered by: Chemat, Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 10g, 25g.
[(E)-4-methoxy-4-oxobut-2-enyl]-triphenylphosphanium bromide (CAS 2181-98-8) is a chemical compound with the molecular formula C23H22BrO2P and a molecular weight of 441.3 g/mol. IUPAC name: [(E)-4-methoxy-4-oxobut-2-enyl]-triphenylphosphanium bromide. InChIKey: KSTXYAKHACCZSD-NWBUNABESA-M.
| Molecular formula | C23H22BrO2P |
|---|---|
| Molecular weight | 441.3 g/mol |
| IUPAC name | [(E)-4-methoxy-4-oxobut-2-enyl]-triphenylphosphanium bromide |
| InChIKey | KSTXYAKHACCZSD-NWBUNABESA-M |
| SMILES | COC(=O)/C=C/C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)