cas: 57611-57-1 — see every product listed under this CAS number, including other names
Methyl 4-Amino-1-benzylpiperidine-4-carboxylate, 97%, 97% (CAS 57611-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RUE-100mg |
| cas | 57611-57-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 500mg | 453.20 Pln | |
| Chemat | 1g | 683.60 Pln | |
| Chemat | 5g | 1955.60 Pln | |
| Chemat | 10g | 3851.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-amino-1-benzylpiperidine-4-carboxylate (CAS 57611-57-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: methyl 4-amino-1-benzylpiperidine-4-carboxylate. InChIKey: GRSLQEBUAGDFDU-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | methyl 4-amino-1-benzylpiperidine-4-carboxylate |
| InChIKey | GRSLQEBUAGDFDU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(CC1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)