cas: 57611-57-1 — see every product listed under this CAS number, including other names
Methyl 4-amino-1-benzylpiperidine-4-carboxylate (CAS 57611-57-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 500mg, 1g. Offered by: Biosynth, Fluorochem.
| brand | Biosynth |
|---|---|
| catalog number | HCA61157-5g |
| cas | 57611-57-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 500mg | 721.64 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3215.55 Pln |
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
Methyl 4-amino-1-benzylpiperidine-4-carboxylate (CAS 57611-57-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: methyl 4-amino-1-benzylpiperidine-4-carboxylate. InChIKey: GRSLQEBUAGDFDU-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | methyl 4-amino-1-benzylpiperidine-4-carboxylate |
| InChIKey | GRSLQEBUAGDFDU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CCN(CC1)CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)