cas: 1321613-02-8 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-chloro-6-fluorobenzoate 97% (CAS 1321613-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A223116-100mg |
| cas | 1321613-02-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 520.56 Pln | |
| Ambeed | 25g | 1210.31 Pln | |
| Ambeed | 100g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A223116 |
Methyl 4-bromo-2-chloro-6-fluorobenzoate (CAS 1321613-02-8) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-fluorobenzoate. InChIKey: MDFGLYHZCDEBLE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-fluorobenzoate |
| InChIKey | MDFGLYHZCDEBLE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Br)F |
Computed by PubChem (NCBI)