Products 2237234-88-5
CAS 2237234-88-5 appears in our catalog under these names: 5-Bromo-4-chloro-2-fluoro-3-methylbenzoic acid, 96%, 5-Bromo-4-chloro-2-fluoro-3-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-bromo-4-chloro-2-fluoro-3-methylbenzoic acid (CAS 2237234-88-5) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: 5-bromo-4-chloro-2-fluoro-3-methylbenzoic acid. InChIKey: VAJOFRCFUWXQDO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | 5-bromo-4-chloro-2-fluoro-3-methylbenzoic acid |
| InChIKey | VAJOFRCFUWXQDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Br)C(=O)O)F |
Computed by PubChem (NCBI)