Methyl 4-bromo-2-chloro-6-fluorobenzoate, 97%
cas: 1321613-02-8 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-chloro-6-fluorobenzoate, 97% (CAS 1321613-02-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g, 50g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A223116-250mg |
| cas | 1321613-02-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 25g | 1221.44 Pln | |
| Ambeed | 100g | 3880.31 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 683.60 Pln | |
| Chemat | 25g | 885.20 Pln | |
| Chemat | 50g | 1638.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-bromo-2-chloro-6-fluorobenzoate (CAS 1321613-02-8) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-fluorobenzoate. InChIKey: MDFGLYHZCDEBLE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-fluorobenzoate |
| InChIKey | MDFGLYHZCDEBLE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Br)F |
Computed by PubChem (NCBI)