cas: 877149-10-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-chloro-6-methylbenzoate, 98% (CAS 877149-10-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F238121-1G |
| cas | 877149-10-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 664.37 Pln | |
| Fluorochem | 10g | 1221.46 Pln | |
| Fluorochem | 25g | 2497.06 Pln | |
| Fluorochem | 100g | 7562.98 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-bromo-2-chloro-6-methylbenzoate (CAS 877149-10-5) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 4-bromo-2-chloro-6-methylbenzoate. InChIKey: KOVCJLYSMXZNDF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 4-bromo-2-chloro-6-methylbenzoate |
| InChIKey | KOVCJLYSMXZNDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)Cl)Br |
Computed by PubChem (NCBI)