cas: 1805190-07-1 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2-fluoro-3-nitrobenzoate, 97%, 97% (CAS 1805190-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I14K-100mg |
| cas | 1805190-07-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 1883.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2-fluoro-3-nitrobenzoate (CAS 1805190-07-1) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 4-bromo-2-fluoro-3-nitrobenzoate. InChIKey: LTYAHOWZDAMGRQ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 4-bromo-2-fluoro-3-nitrobenzoate |
| InChIKey | LTYAHOWZDAMGRQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)