cas: 1427440-57-0 — see every product listed under this CAS number, including other names
Methyl 4-bromo-3-chloro-2-fluorobenzoate 95+% (CAS 1427440-57-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A641325-250mg |
| cas | 1427440-57-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 859.88 Pln | |
| Ambeed | 25g | 4019.38 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A641325 |
Methyl 4-bromo-3-chloro-2-fluorobenzoate (CAS 1427440-57-0) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: methyl 4-bromo-3-chloro-2-fluorobenzoate. InChIKey: DORFWUUEBUVBPV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | methyl 4-bromo-3-chloro-2-fluorobenzoate |
| InChIKey | DORFWUUEBUVBPV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)Br)Cl)F |
Computed by PubChem (NCBI)