cas: 1379366-11-6 — see every product listed under this CAS number, including other names
Methyl 4-bromo-5-chloro-2-fluorobenzoate, 95%, 95% (CAS 1379366-11-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12ACU6-100mg |
| cas | 1379366-11-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-5-chloro-2-fluorobenzoate (CAS 1379366-11-6) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: methyl 4-bromo-5-chloro-2-fluorobenzoate. InChIKey: QOAMJQQYVZEHHS-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | methyl 4-bromo-5-chloro-2-fluorobenzoate |
| InChIKey | QOAMJQQYVZEHHS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)Br)Cl |
Computed by PubChem (NCBI)