cas: 85392-01-4 — see every product listed under this CAS number, including other names
Methyl 4-chloro-2-(chlorosulfonyl)benzoate 98% (CAS 85392-01-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A239351-100mg |
| cas | 85392-01-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 286.94 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 665.19 Pln | |
| Ambeed | 5g | 2139.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A239351 |
Methyl 4-chloro-2-chlorosulfonylbenzoate (CAS 85392-01-4) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: methyl 4-chloro-2-chlorosulfonylbenzoate. InChIKey: AKVPERSFJZUJKD-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | methyl 4-chloro-2-chlorosulfonylbenzoate |
| InChIKey | AKVPERSFJZUJKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)