CAS 924859-46-1 is the registry number for Methyl 2-chloro-5-(chlorosulfonyl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl 2-chloro-5-chlorosulfonylbenzoate (CAS 924859-46-1) is a chemical compound with the molecular formula C8H6Cl2O4S and a molecular weight of 269.10 g/mol. IUPAC name: methyl 2-chloro-5-chlorosulfonylbenzoate. InChIKey: OCXSMSBPMSQANO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O4S |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | methyl 2-chloro-5-chlorosulfonylbenzoate |
| InChIKey | OCXSMSBPMSQANO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)