cas: 176694-36-3 — see every product listed under this CAS number, including other names
Methyl 4-fluoro-3-(trifluoromethyl)benzoate 98% (CAS 176694-36-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121065-1g |
| cas | 176694-36-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 437.12 Pln | |
| Ambeed | 100g | 1510.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121065 |
Methyl 4-fluoro-3-(trifluoromethyl)benzoate (CAS 176694-36-3) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: methyl 4-fluoro-3-(trifluoromethyl)benzoate. InChIKey: IRYBOHVMFKZODT-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | methyl 4-fluoro-3-(trifluoromethyl)benzoate |
| InChIKey | IRYBOHVMFKZODT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)