cas: 1261880-87-8 — see every product listed under this CAS number, including other names
Methyl 4-iodo-3-(trifluoromethyl)benzoate 97% (CAS 1261880-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A665458-250mg |
| cas | 1261880-87-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1749.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A665458 |
Methyl 4-iodo-3-(trifluoromethyl)benzoate (CAS 1261880-87-8) is a chemical compound with the molecular formula C9H6F3IO2 and a molecular weight of 330.04 g/mol. IUPAC name: methyl 4-iodo-3-(trifluoromethyl)benzoate. InChIKey: QUHBVHFIZYIFAP-UHFFFAOYSA-N.
| Molecular formula | C9H6F3IO2 |
|---|---|
| Molecular weight | 330.04 g/mol |
| IUPAC name | methyl 4-iodo-3-(trifluoromethyl)benzoate |
| InChIKey | QUHBVHFIZYIFAP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)