cas: 1261880-87-8 — see every product listed under this CAS number, including other names
Methyl 4-iodo-3-(trifluoromethyl)benzoate, 97%, 97% (CAS 1261880-87-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111S47-250mg |
| cas | 1261880-87-8 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 405.20 Pln | |
| Chemat | 5g | 1269.20 Pln | |
| Chemat | 10g | 1994.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-iodo-3-(trifluoromethyl)benzoate (CAS 1261880-87-8) is a chemical compound with the molecular formula C9H6F3IO2 and a molecular weight of 330.04 g/mol. IUPAC name: methyl 4-iodo-3-(trifluoromethyl)benzoate. InChIKey: QUHBVHFIZYIFAP-UHFFFAOYSA-N.
| Molecular formula | C9H6F3IO2 |
|---|---|
| Molecular weight | 330.04 g/mol |
| IUPAC name | methyl 4-iodo-3-(trifluoromethyl)benzoate |
| InChIKey | QUHBVHFIZYIFAP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)