cas: 2377608-56-3 — see every product listed under this CAS number, including other names
Methyl 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%, 98% (CAS 2377608-56-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWIV-100mg |
| cas | 2377608-56-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2680.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 2377608-56-3) is a chemical compound with the molecular formula C14H18BNO6 and a molecular weight of 307.11 g/mol. IUPAC name: methyl 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: FXCJFBMJVRLCKL-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO6 |
|---|---|
| Molecular weight | 307.11 g/mol |
| IUPAC name | methyl 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | FXCJFBMJVRLCKL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)