cas: 1379369-63-7 — see every product listed under this CAS number, including other names
Methyl 5-amino-6-bromonicotinate, 98% (CAS 1379369-63-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A237578-1g |
| cas | 1379369-63-7 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8956.15 Pln | |
| Fluorochem | 100mg | 1643.19 Pln | |
| Fluorochem | 250mg | 2658.46 Pln | |
| Fluorochem | 500mg | 4454.70 Pln | |
| Fluorochem | 1g | 5579.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 5-amino-6-bromopyridine-3-carboxylate (CAS 1379369-63-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: methyl 5-amino-6-bromopyridine-3-carboxylate. InChIKey: IKKSIKVBKBKPBF-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | methyl 5-amino-6-bromopyridine-3-carboxylate |
| InChIKey | IKKSIKVBKBKPBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Br)N |
Computed by PubChem (NCBI)