cas: 1219210-17-9 — see every product listed under this CAS number, including other names
Methyl 5-broMo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride, 95%, 95% (CAS 1219210-17-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12ANFW-100mg |
| cas | 1219210-17-9 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-bromo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride (CAS 1219210-17-9) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: methyl 5-bromo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride. InChIKey: IJLORLGDTCOFRU-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | methyl 5-bromo-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydrochloride |
| InChIKey | IJLORLGDTCOFRU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(CN1)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)