CAS 1187932-42-8 is the registry number for tert-Butyl N-(3-bromo-5-chlorophenyl)carbamate, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Tert-butyl N-(3-bromo-5-chlorophenyl)carbamate (CAS 1187932-42-8) is a chemical compound with the molecular formula C11H13BrClNO2 and a molecular weight of 306.58 g/mol. IUPAC name: tert-butyl N-(3-bromo-5-chlorophenyl)carbamate. InChIKey: VVRHVJMRXVANCP-UHFFFAOYSA-N.
| Molecular formula | C11H13BrClNO2 |
|---|---|
| Molecular weight | 306.58 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-5-chlorophenyl)carbamate |
| InChIKey | VVRHVJMRXVANCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)