Methyl 5-bromo-2-chloro-6-methylnicotinate, 98%
cas: 1935335-95-7 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-chloro-6-methylnicotinate, 98% (CAS 1935335-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1014246-100mg |
| cas | 1935335-95-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 364.81 Pln | |
| Ambeed | 1g | 1160.25 Pln | |
| Ambeed | 5g | 3902.56 Pln | |
| Ambeed | 10g | 7540.44 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 392.11 Pln | |
| BLDpharm | 1g | 1247.36 Pln | |
| BLDpharm | 5g | 4201.88 Pln | |
| BLDpharm | 10g | 8128.27 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 851.60 Pln | |
| Chemat | 5g | 2843.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 5-bromo-2-chloro-6-methylpyridine-3-carboxylate (CAS 1935335-95-7) is a chemical compound with the molecular formula C8H7BrClNO2 and a molecular weight of 264.50 g/mol. IUPAC name: methyl 5-bromo-2-chloro-6-methylpyridine-3-carboxylate. InChIKey: XWYPYOGYRFEUTO-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClNO2 |
|---|---|
| Molecular weight | 264.50 g/mol |
| IUPAC name | methyl 5-bromo-2-chloro-6-methylpyridine-3-carboxylate |
| InChIKey | XWYPYOGYRFEUTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=N1)Cl)C(=O)OC)Br |
Computed by PubChem (NCBI)
