cas: 1154278-17-7 — see every product listed under this CAS number, including other names
Methyl 5-bromo-2-fluoro-3-nitrobenzoate 95% (CAS 1154278-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A238040-250mg |
| cas | 1154278-17-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 1115.75 Pln | |
| Ambeed | 100g | 2267.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A238040 |
Methyl 5-bromo-2-fluoro-3-nitrobenzoate (CAS 1154278-17-7) is a chemical compound with the molecular formula C8H5BrFNO4 and a molecular weight of 278.03 g/mol. IUPAC name: methyl 5-bromo-2-fluoro-3-nitrobenzoate. InChIKey: ODDWYOBMSSXDDU-UHFFFAOYSA-N.
| Molecular formula | C8H5BrFNO4 |
|---|---|
| Molecular weight | 278.03 g/mol |
| IUPAC name | methyl 5-bromo-2-fluoro-3-nitrobenzoate |
| InChIKey | ODDWYOBMSSXDDU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)