cas: 946604-99-5 — see every product listed under this CAS number, including other names
Methyl 5-bromo-3-((tert-butoxycarbonyl)amino)thiophene-2-carboxylate, 96% (CAS 946604-99-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F619664-100MG |
| cas | 946604-99-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1372.45 Pln | |
| Fluorochem | 1g | 2950.02 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylate (CAS 946604-99-5) is a chemical compound with the molecular formula C11H14BrNO4S and a molecular weight of 336.20 g/mol. IUPAC name: methyl 5-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylate. InChIKey: OQCNMXAYFCAWPE-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO4S |
|---|---|
| Molecular weight | 336.20 g/mol |
| IUPAC name | methyl 5-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]thiophene-2-carboxylate |
| InChIKey | OQCNMXAYFCAWPE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(SC(=C1)Br)C(=O)OC |
Computed by PubChem (NCBI)