CAS 926199-51-1 appears in our catalog under these names: 4-Bromo-3-(tert-butylsulfamoyl)benzoic acid, 95%, 4-Bromo-3-(tert-butylsulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
4-bromo-3-(tert-butylsulfamoyl)benzoic acid (CAS 926199-51-1) is a chemical compound with the molecular formula C11H14BrNO4S and a molecular weight of 336.20 g/mol. IUPAC name: 4-bromo-3-(tert-butylsulfamoyl)benzoic acid. InChIKey: RZNBWQJNZUAACD-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO4S |
|---|---|
| Molecular weight | 336.20 g/mol |
| IUPAC name | 4-bromo-3-(tert-butylsulfamoyl)benzoic acid |
| InChIKey | RZNBWQJNZUAACD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)