cas: 1221792-83-1 — see every product listed under this CAS number, including other names
Methyl 5-bromobenzo[d]oxazole-7-carboxylate 95+% (CAS 1221792-83-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333119-100mg |
| cas | 1221792-83-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 715.25 Pln | |
| Ambeed | 1g | 1254.81 Pln | |
| Ambeed | 5g | 5888.38 Pln |
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A333119 |
Methyl 5-bromo-1,3-benzoxazole-7-carboxylate (CAS 1221792-83-1) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: methyl 5-bromo-1,3-benzoxazole-7-carboxylate. InChIKey: DGDQPSFSPDVBEL-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | methyl 5-bromo-1,3-benzoxazole-7-carboxylate |
| InChIKey | DGDQPSFSPDVBEL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC(=C1)Br)N=CO2 |
Computed by PubChem (NCBI)