CAS 1934686-68-6 is the registry number for 7-Bromo-benzooxazole-5-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
Methyl 7-bromo-1,3-benzoxazole-5-carboxylate (CAS 1934686-68-6) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: methyl 7-bromo-1,3-benzoxazole-5-carboxylate. InChIKey: SSXSKRGVEMIYET-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | methyl 7-bromo-1,3-benzoxazole-5-carboxylate |
| InChIKey | SSXSKRGVEMIYET-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Br)OC=N2 |
Computed by PubChem (NCBI)