cas: 16220-99-8 — see every product listed under this CAS number, including other names
Methyl 5-bromomethyl-2-chlorobenzoate, 97% (CAS 16220-99-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390186-250MG |
| cas | 16220-99-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2226.32 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-(bromomethyl)-2-chlorobenzoate (CAS 16220-99-8) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 5-(bromomethyl)-2-chlorobenzoate. InChIKey: CATAJHNFXWLJRA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 5-(bromomethyl)-2-chlorobenzoate |
| InChIKey | CATAJHNFXWLJRA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CBr)Cl |
Computed by PubChem (NCBI)