cas: 1109284-49-2 — see every product listed under this CAS number, including other names
Methyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate, 98% (CAS 1109284-49-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621143-100MG |
| cas | 1109284-49-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 1g | 1809.80 Pln | |
| Fluorochem | 5g | 6292.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate (CAS 1109284-49-2) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: methyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate. InChIKey: HRMDSSJQNZPJAT-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | methyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-2-carboxylate |
| InChIKey | HRMDSSJQNZPJAT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(SC(=C2)C(=O)OC)C |
Computed by PubChem (NCBI)