cas: 885326-88-5 — see every product listed under this CAS number, including other names
Methyl 6-amino-4-bromopicolinate 97% (CAS 885326-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A352892-100mg |
| cas | 885326-88-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2267.19 Pln | |
| Ambeed | 5g | 8869.88 Pln | |
| Ambeed | 10g | 14716.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A352892 |
Methyl 6-amino-4-bromopyridine-2-carboxylate (CAS 885326-88-5) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: methyl 6-amino-4-bromopyridine-2-carboxylate. InChIKey: IVNUJUSMGMFTJA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | methyl 6-amino-4-bromopyridine-2-carboxylate |
| InChIKey | IVNUJUSMGMFTJA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)