cas: 2244107-78-4 — see every product listed under this CAS number, including other names
Methyl 6-bromo-2-chloro-3-methylbenzoate (CAS 2244107-78-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630818-5G |
| cas | 2244107-78-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 8791.71 Pln | |
| Fluorochem | 1g | 2981.26 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 6-bromo-2-chloro-3-methylbenzoate (CAS 2244107-78-4) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: methyl 6-bromo-2-chloro-3-methylbenzoate. InChIKey: DVEXRJMIIFVIOK-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | methyl 6-bromo-2-chloro-3-methylbenzoate |
| InChIKey | DVEXRJMIIFVIOK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C(=O)OC)Cl |
Computed by PubChem (NCBI)