cas: 954239-67-9 — see every product listed under this CAS number, including other names
Methyl 6-bromobenzo[d]oxazole-2-carboxylate, 98%, 98% (CAS 954239-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1171AF-100mg |
| cas | 954239-67-9 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2805.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 6-bromo-1,3-benzoxazole-2-carboxylate (CAS 954239-67-9) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: methyl 6-bromo-1,3-benzoxazole-2-carboxylate. InChIKey: SLACEVLLDFPFJF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | methyl 6-bromo-1,3-benzoxazole-2-carboxylate |
| InChIKey | SLACEVLLDFPFJF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC2=C(O1)C=C(C=C2)Br |
Computed by PubChem (NCBI)