cas: 915107-30-1 — see every product listed under this CAS number, including other names
Methyl 6-chloro-5-hydroxynicotinate, 98% (CAS 915107-30-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A119762-10g |
| cas | 915107-30-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 9802.45 Pln | |
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 1091.30 Pln | |
| Fluorochem | 5g | 3704.96 Pln | |
| Fluorochem | 10g | 7354.72 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 6-chloro-5-hydroxypyridine-3-carboxylate (CAS 915107-30-1) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: methyl 6-chloro-5-hydroxypyridine-3-carboxylate. InChIKey: ZDIHYBCAMKQMID-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | methyl 6-chloro-5-hydroxypyridine-3-carboxylate |
| InChIKey | ZDIHYBCAMKQMID-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)O |
Computed by PubChem (NCBI)