cas: 1427460-96-5 — see every product listed under this CAS number, including other names
Methyl 7-Bromo-1H-indazole-5-carboxylate, 98%, 98% (CAS 1427460-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110YF1-100mg |
| cas | 1427460-96-5 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 500g | 19689.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 7-bromo-1H-indazole-5-carboxylate (CAS 1427460-96-5) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 7-bromo-1H-indazole-5-carboxylate. InChIKey: KSHNFDKDSIQAGL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 7-bromo-1H-indazole-5-carboxylate |
| InChIKey | KSHNFDKDSIQAGL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C(=C1)Br)NN=C2 |
Computed by PubChem (NCBI)