cas: 356-24-1 — see every product listed under this CAS number, including other names
Methyl Heptafluorobutyrate, >97.0%(GC) (CAS 356-24-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H1033-5G |
| cas | 356-24-1 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 449.29 Pln | |
| TCI | 25g | 1231.13 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Methyl 2,2,3,3,4,4,4-heptafluorobutanoate (CAS 356-24-1) is a chemical compound with the molecular formula C5H3F7O2 and a molecular weight of 228.06 g/mol. IUPAC name: methyl 2,2,3,3,4,4,4-heptafluorobutanoate. InChIKey: MRPUVAKBXDBGJQ-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O2 |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChIKey | MRPUVAKBXDBGJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)