Products 356-24-1
CAS 356-24-1 appears in our catalog under these names: Methyl heptafluorobutyrate, 97%, Methyl Heptafluorobutyrate, >95% (GC), Perfluorobutanoic acid-methyl ester, Methyl Heptafluorobutyrate, Methyl Heptafluorobutyrate, >97.0%(GC). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 25g, 5g, 1g, 500mg, 100mg, 100g.
Methyl 2,2,3,3,4,4,4-heptafluorobutanoate (CAS 356-24-1) is a chemical compound with the molecular formula C5H3F7O2 and a molecular weight of 228.06 g/mol. IUPAC name: methyl 2,2,3,3,4,4,4-heptafluorobutanoate. InChIKey: MRPUVAKBXDBGJQ-UHFFFAOYSA-N.
| Molecular formula | C5H3F7O2 |
|---|---|
| Molecular weight | 228.06 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChIKey | MRPUVAKBXDBGJQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Methyl heptafluorobutyrate, Methyl 2,2,3,3,4,4,4-heptafluorobutanoate, Methyl perfluorobutyrate, Butanoic acid, heptafluoro-, methyl ester, Heptafluorobutyryl methyl ester, 2,2,3,3,4,4,4-Heptafluoro-butyric acid methyl ester, Methyl heptafluorobutanoate, Methyl perfluorobutanoate, Heptafluorobutyric acid methyl ester, Butyric acid, heptafluoro-, methyl ester