CAS 711-01-3 appears in our catalog under these names: 1-Adamantanecarboxylic Acid Methyl Ester, 1–Adamantanecarboxylic Acid Methyl Ester, Methyl 1-Adamantanecarboxylate, >98.0%(GC), Methyl adamantane-1-carboxylate, 97%, 97%, Methyl adamantane-1-carboxylate, 98%. Offered by: TRC, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100g, 25g, 5g.
Methyl adamantane-1-carboxylate (CAS 711-01-3) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: methyl adamantane-1-carboxylate. InChIKey: CLYOOVNORYNXMD-UHFFFAOYSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | methyl adamantane-1-carboxylate |
| InChIKey | CLYOOVNORYNXMD-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)