cas: 301-00-8 — see every product listed under this CAS number, including other names
Methyl linolenate (CAS 301-00-8) is a chemical reagent available from Chemat. Available pack sizes: 1x100mg, 1g, 5g, 25g, 100g, 500g. Offered by: HPC Standards, Fluorochem.
| brand | HPC Standards |
|---|---|
| catalog number | 683681-1x100mg |
| cas | 301-00-8 |
| size | 1x100mg |
| brand | size | price | |
|---|---|---|---|
| HPC Standards | 1x100mg | 306.92 Pln | |
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 966.34 Pln | |
| Fluorochem | 500g | 3043.74 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl linolenate is a fatty acid methyl ester derived from alpha-linolenic acid. It has a role as an insect attractant and a plant metabolite. It is functionally related to an alpha-linolenic acid.
Source: ChEBI
| Molecular formula | C19H32O2 |
|---|---|
| Molecular weight | 292.5 g/mol |
| IUPAC name | methyl (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| InChIKey | DVWSXZIHSUZZKJ-YSTUJMKBSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)