cas: 2306278-42-0 — see every product listed under this CAS number, including other names
Methyl6-bromo-8-fluoro-quinoline-3-carboxylate, 97% (CAS 2306278-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F718989-100MG |
| cas | 2306278-42-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1351.63 Pln | |
| Fluorochem | 250mg | 2200.28 Pln | |
| Fluorochem | 500mg | 3621.66 Pln | |
| Fluorochem | 1g | 5386.66 Pln | |
| Fluorochem | 5g | 16023.54 Pln | |
| Fluorochem | 10g | 26655.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-bromo-8-fluoroquinoline-3-carboxylate (CAS 2306278-42-0) is a chemical compound with the molecular formula C11H7BrFNO2 and a molecular weight of 284.08 g/mol. IUPAC name: methyl 6-bromo-8-fluoroquinoline-3-carboxylate. InChIKey: QUZCBYABJIIIGQ-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFNO2 |
|---|---|
| Molecular weight | 284.08 g/mol |
| IUPAC name | methyl 6-bromo-8-fluoroquinoline-3-carboxylate |
| InChIKey | QUZCBYABJIIIGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CC(=CC(=C2N=C1)F)Br |
Computed by PubChem (NCBI)