Products 2892253-10-8
CAS 2892253-10-8 is the registry number for 6'-Bromo-5'-fluoro-1'H-spiro[cyclopropane-1,4'-isoquinoline]-1',3'(2'H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6'-bromo-5'-fluorospiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione (CAS 2892253-10-8) is a chemical compound with the molecular formula C11H7BrFNO2 and a molecular weight of 284.08 g/mol. IUPAC name: 6'-bromo-5'-fluorospiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione. InChIKey: LGJGARKCDZCTRW-UHFFFAOYSA-N.
| Molecular formula | C11H7BrFNO2 |
|---|---|
| Molecular weight | 284.08 g/mol |
| IUPAC name | 6'-bromo-5'-fluorospiro[cyclopropane-1,4'-isoquinoline]-1',3'-dione |
| InChIKey | LGJGARKCDZCTRW-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=CC(=C3F)Br)C(=O)NC2=O |
Computed by PubChem (NCBI)