cas: 1621616-14-5 — see every product listed under this CAS number, including other names
Methylamino-PEG4-Boc, 98% (CAS 1621616-14-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F987124-100MG |
| cas | 1621616-14-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1643.19 Pln | |
| Fluorochem | 5g | 6422.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1621616-14-5) is a chemical compound with the molecular formula C16H33NO6 and a molecular weight of 335.44 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZNZXARLRHZPMJU-UHFFFAOYSA-N.
| Molecular formula | C16H33NO6 |
|---|---|
| Molecular weight | 335.44 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZNZXARLRHZPMJU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCNC |
Computed by PubChem (NCBI)