CAS 18375-62-7 is the registry number for (2R,3S,4R,5R)-N-Decyl-2,3,4,5,6-pentahydroxyhexanamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R,3S,4R,5R)-N-decyl-2,3,4,5,6-pentahydroxyhexanamide (CAS 18375-62-7) is a chemical compound with the molecular formula C16H33NO6 and a molecular weight of 335.44 g/mol. IUPAC name: (2R,3S,4R,5R)-N-decyl-2,3,4,5,6-pentahydroxyhexanamide. InChIKey: REISOHCMNXKYLD-APIJFGDWSA-N.
| Molecular formula | C16H33NO6 |
|---|---|
| Molecular weight | 335.44 g/mol |
| IUPAC name | (2R,3S,4R,5R)-N-decyl-2,3,4,5,6-pentahydroxyhexanamide |
| InChIKey | REISOHCMNXKYLD-APIJFGDWSA-N |
| SMILES | CCCCCCCCCCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
Computed by PubChem (NCBI)