CAS 1345955-28-3 appears in our catalog under these names: Methyltetrazine-Amine/ 97.59% (existing batch purity), Methyltetrazine–Amine, Methyltetrazine amine, Methyltetrazine-Amine 97%, (4-(6-Methyl-1,2,4,5-tetrazin-3-yl)phenyl)methanamine, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 1g.
[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride (CAS 1345955-28-3) is a chemical compound with the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. IUPAC name: [4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride. InChIKey: NIGOLWATPZTKQT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN5 |
|---|---|
| Molecular weight | 237.69 g/mol |
| IUPAC name | [4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine;hydrochloride |
| InChIKey | NIGOLWATPZTKQT-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)CN.Cl |
Computed by PubChem (NCBI)