CAS 375345-95-2 appears in our catalog under these names: (R)-N-(2-(4'-(2-(Methylsulfonamido)ethyl)-[1,1'-biphenyl]-4-yl)propyl)propane-2-sulfonamide, 98+%, 98+%, Mibampator/ 97.63% (existing batch purity), LY451395, Mibampator, Mibampator 98+%. Offered by: Chemat, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 1mg.
N-[(2R)-2-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]phenyl]propyl]propane-2-sulfonamide (CAS 375345-95-2) is a chemical compound with the molecular formula C21H30N2O4S2 and a molecular weight of 438.6 g/mol. IUPAC name: N-[(2R)-2-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]phenyl]propyl]propane-2-sulfonamide. InChIKey: ULRDYYKSPCRXAJ-KRWDZBQOSA-N.
| Molecular formula | C21H30N2O4S2 |
|---|---|
| Molecular weight | 438.6 g/mol |
| IUPAC name | N-[(2R)-2-[4-[4-[2-(methanesulfonamido)ethyl]phenyl]phenyl]propyl]propane-2-sulfonamide |
| InChIKey | ULRDYYKSPCRXAJ-KRWDZBQOSA-N |
| SMILES | C[C@@H](CNS(=O)(=O)C(C)C)C1=CC=C(C=C1)C2=CC=C(C=C2)CCNS(=O)(=O)C |
Computed by PubChem (NCBI)