Products 105051-87-4
CAS 105051-87-4 appears in our catalog under these names: Minamestane/ 99.04% (existing batch purity), Minamestane. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
(8R,9S,10R,13S,14S)-4-amino-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione (CAS 105051-87-4) is a chemical compound with the molecular formula C19H23NO2 and a molecular weight of 297.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-4-amino-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione. InChIKey: DAKHYLIFCYPHQW-KZQROQTASA-N.
| Molecular formula | C19H23NO2 |
|---|---|
| Molecular weight | 297.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-4-amino-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione |
| InChIKey | DAKHYLIFCYPHQW-KZQROQTASA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)C=CC4=C(C(=O)C=C[C@]34C)N |
Computed by PubChem (NCBI)