CAS 1334850-99-5 appears in our catalog under these names: Mito–TEMPO, Mito-TEMPO/ 99.12% (existing batch purity), Mito-TEMPO, Mito-TEMPO 98%, 2,2,6,6-Tetramethyl-4-[[2-(triphenylphosphonio)acetyl]amino]-1-piperidinyloxy chloride, 98%, 98%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso), 250mg.
CAS 1334850-99-5 identifies a chemical compound with the molecular formula C29H35ClN2O2P and a molecular weight of 510.0 g/mol. InChIKey: WKKFJIJNGHNQQW-UHFFFAOYSA-N.
| Molecular formula | C29H35ClN2O2P |
|---|---|
| Molecular weight | 510.0 g/mol |
| InChIKey | WKKFJIJNGHNQQW-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1[O])(C)C)NC(=O)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C.[Cl-] |
Computed by PubChem (NCBI)