CAS 303215-67-0 appears in our catalog under these names: MitoBloCK-6/ 98.14% (existing batch purity), MitoBloCK–6, 2-(((4-Anilinophenyl)imino)methyl)-4,6-dichlorophenol, MitoBloCK-6, 98.07%, 2-[[(4-Anilinophenyl)imino]methyl]-4,6-dichlorophenol, 95%, 95%. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
2-[(4-anilinophenyl)iminomethyl]-4,6-dichlorophenol (CAS 303215-67-0) is a chemical compound with the molecular formula C19H14Cl2N2O and a molecular weight of 357.2 g/mol. IUPAC name: 2-[(4-anilinophenyl)iminomethyl]-4,6-dichlorophenol. InChIKey: DBYOPSAQYAKIQV-UHFFFAOYSA-N.
| Molecular formula | C19H14Cl2N2O |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | 2-[(4-anilinophenyl)iminomethyl]-4,6-dichlorophenol |
| InChIKey | DBYOPSAQYAKIQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)N=CC3=C(C(=CC(=C3)Cl)Cl)O |
Computed by PubChem (NCBI)