CAS 13726-76-6 appears in our catalog under these names: Boc–L–Arg–OH, N(alpha)-Boc-L-arginine, 98% , Boc-Arg-OH, >98.0%(HPLC), Boc-Arg-OH 95%, N-ALPHA-(TERT-BUTOXYCARBONYL)-L-ARGININE. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 5g, 1000g, 10g, 25g, 100g, 500g, 1kg.
(2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 13726-76-6) is a chemical compound with the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: HSQIYOPBCOPMSS-ZETCQYMHSA-N.
| Molecular formula | C11H22N4O4 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | HSQIYOPBCOPMSS-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)