cas: 160256-75-7 — see every product listed under this CAS number, including other names
N,N"-Di-Z-diethylenetriamine 98% (CAS 160256-75-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A363174-250mg |
| cas | 160256-75-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A363174 |
Benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate (CAS 160256-75-7) is a chemical compound with the molecular formula C20H25N3O4 and a molecular weight of 371.4 g/mol. IUPAC name: benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate. InChIKey: DWPBEWIGNADCAX-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O4 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | benzyl N-[2-[2-(phenylmethoxycarbonylamino)ethylamino]ethyl]carbamate |
| InChIKey | DWPBEWIGNADCAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCNCCNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)